ClassyFire: Listing 4825 chemical categories

Export to:

Select 'All' to list all the chemical categories. Each character links to a view of all chemical categories whose name begin by it. The asterisk (*) links to a view of all categories whose name start with a special character (e.g. '('). You can search the table for a specific string within that specific view.

Name	ChemOnt ID	Description
O-acylglycerone-phosphates	CHEMONTID:0003448	Glycerone-3-phosphates carrying an acyl substituent at the 1-position.
O-alkylglycerone phosphates	CHEMONTID:0003447	Glycerone-3-phosphates carrying an alkyl substituent at the 1-position.
O-alkylglycerones	CHEMONTID:0003445	Organic compounds containing a glycerone that carries an acyl substituent at the 1-position or the 2-position.
O-alkylpyrimidines	CHEMONTID:0004486	Compounds containing a pyrimidine , which is O-alkylated at one or more ring positions.
o-Aminophenols	CHEMONTID:0004654	Phenols that are substituted with an amine group at the 2-position of the benzene ring.
O-benzoquinones	CHEMONTID:0002492	Benzoquinones where the two C=O groups are attached at the 1- and 2-positions, respectively.
O-bromophenols	CHEMONTID:0002768	Bromophenols carrying a iodine at the C2 position of the benzene ring.
O-chlorophenols	CHEMONTID:0002771	Chlorophenols carrying a iodine at the C2 position of the benzene ring.
O-cinnamoyl glycosides	CHEMONTID:0003479	O-glycoside derivatives of cinnamic acid. Cinnamic acid is an aromatic compound containing a benzene and a carboxylic acid group forming 3-phenylprop-2-enoic acid.
O-coumaroyl glycosides	CHEMONTID:0002684	Glycosides of o-coumaric acids. O-coumaric acids are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 carbon atom of the benzene ring.
O-fluorophenols	CHEMONTID:0002774	Fluorophenols carrying a iodine at the C2 position of the benzene ring.
O-galloylquinic acids and derivatives	CHEMONTID:0002513	Compounds containing a galloic acid moiety, linked to one hydroxyl group of a quinic acid moiety.
O-glucuronides	CHEMONTID:0002813	Glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond.
O-glycosyl compounds	CHEMONTID:0002207	Glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.
O-haloacetanilides	CHEMONTID:0004718	Organic compounds containing an acetamide group conjugated to a phenyl group, which is in turn ortho-substituted with a halogen atom.
o-Hydroxybenzoic acid esters	CHEMONTID:0004700	Benzoic acid esters where the benzene ring is ortho-substituted with a hydroxy group.
O-iminoquinones	CHEMONTID:0002388	O-quinones that carry an imine group.
O-iodophenols	CHEMONTID:0002777	Iodophenols carrying a iodine at the C2 position of the benzene ring.
O-methoxybenzoic acids and derivatives	CHEMONTID:0002345	Benzoic acids in which the hydrogen atom at position 2 of the benzene ring is replaced by a methoxy group.
O-methylated flavonoids	CHEMONTID:0002585	Flavonoids with methoxy groups conjugated to the flavonoid backbone.
O-methylated isoflavonoids	CHEMONTID:0002586	Isoflavonoids with methoxy groups conjugated to the isoflavonoid backbone. Isoflavonoids are natural products derived from 3-phenylchromen-4-one.
O-phenylenediamines	CHEMONTID:0004746	Aromatic compound containing a benzene ring which carries 2 amino groups, at the 1- and 2-positions.
O-phenylhydroxylamines	CHEMONTID:0004651	Hydroxylamines that are O-substituted with a phenyl group.
o-Phthalate esters	CHEMONTID:0004011	Ester derivatives of o-phthalic acids, which are based on a benzene 1,2-dicarboxylic acid skeleton.
O-phthalic acid and derivatives	CHEMONTID:0001107	Compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 3.
O-quinodimethanes	CHEMONTID:0001778	Compounds containing a benzene ring conjugated to two methylidene groups at carbon atoms 1 and 2, respectively.
O-quinomethanes	CHEMONTID:0002122	Organic compounds containing a benzene ring conjugated to a methylidene group and a ketone at carbon atoms 1 and 2, respectively.
O-quinones	CHEMONTID:0002385	Quinones where the two C=O groups are attached at the 1- and 2-positions, respectively.
O-quinonimines	CHEMONTID:0002894	Quinonimines in which the imine groups are in a ortho-relationship.
O-sulfanylbenzoic acids	CHEMONTID:0003106	Benzoic acids which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively.
O-sulfanylbenzoic acids and derivatives	CHEMONTID:0003105	Benzoic acids (or derivatives) which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively.
O-terphenyls	CHEMONTID:0001836	Terphenyls with a structure containing the 1,2-diphenylbenzene skeleton.
O-thiocarbamates	CHEMONTID:0004425	O-ester derivatives of thiocarbamic acid, with the general formula ROC(=S)NR2.
o-Toluamides	CHEMONTID:0004221	Aromatic compounds containing a toluene, which carries a carboxamide group a the 2-position.
o-Xylenes	CHEMONTID:0004210	Aromatic compounds that contain a o-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions.
o-Xylenols	CHEMONTID:0004214	Aromatic compounds that contain a o-xylenol moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions, and at least one hydroxyl group.
Ochratoxins and related substances	CHEMONTID:0001787	A group of chemically related metabolites containing a 3,4-dihydro-3-methylisocoumarin moiety linked through a carboxyl group to L-beta-phenylalanine by a secondary amine bond.
Octoses	CHEMONTID:0001500	Monosaccharide compounds in which the sugar moiety is an octose (8 carbon atoms).
Okadaic acids and derivatives	CHEMONTID:0001802	Marine heterocyclic polyethers containing the okadaic acid skeleton.
Oleanane triterpenoids	CHEMONTID:0000180	Triterpenoids with a structure based on the oleanane skeleton, an 4,4,6a,8a,11,14b-heptamethyl-hexadecahydropicene derivative.
Olefins	CHEMONTID:0002838	Acyclic and cyclic hydrocarbons having one or more carbon-carbon double bonds, apart from the formal ones in aromatic compounds. The class of olefins subsumes alkenes and cycloalkenes and the corresponding polyenes.
Oligoanthrilamides	CHEMONTID:0001956	Compounds containing several anthranilamide (2-aminobenzamide) moieties, where the amine group of one moiety is bound to the amide group of another moiety.
Oligocarbamates	CHEMONTID:0001955	Compounds containing several carbamate groups linked to each other.
Oligonucleotides	CHEMONTID:0004351	Organic polymers made up of a sequence of 3 to 12 purine or pyrimidine nucleotide residues linked to one another from the 5' -end to the 3'-end through a phosphate group.
Oligopeptides	CHEMONTID:0004831	Organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds.
Oligophosphenes	CHEMONTID:0002488	Organophosphorus compounds with the general formula RP=P-PR' (R=alkyl, aryl).
Oligosaccharide phosphates	CHEMONTID:0002191	Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more phosphate groups.
Oligosaccharide sulfates	CHEMONTID:0003308	Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more sulfate groups.
Oligosaccharides	CHEMONTID:0000198	Carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
Oligosulfones	CHEMONTID:0001954	Compounds containing several sulfone groups linked to each other.
Oligosulfoxides	CHEMONTID:0001953	Compounds containing several sulfoxide groups linked to each other. They have the general formula R1(S(O)C(R2)C)nC (R1 = organyl; R2=any group).
Oligothioureas	CHEMONTID:0001944	Compounds containing several thiourea groups linked to each other.
Oligourea amides	CHEMONTID:0001952	Compounds containing several urea-amide units (RNC(=O)CNC(=O)N(R')CN), which consists of alternating amide and urea functional groups.
Oligoureas	CHEMONTID:0001951	Compounds containing several urea groups linked to each other. Urea is an organic compound with the formula CO(NH2)2.
Ophiobolane sesterterpenoids	CHEMONTID:0002882	Sesterterpnoids with a structure based on the ophiobolane backbone. Ophiobolane is a tricyclic compound consisting of two cyclopentane rings joined by a cyclooctane ring, and carries a methyl group at the 1-, 4-, and 8-position, as well as a 6-methylheptane group at the 12-position.
Organic 1,3-dipolar compounds	CHEMONTID:0003630	Electrically neutral organic molecules carrying a positive and a negative charge in one of their major canonical descriptions. In most dipolar compounds the charges are delocalized; however the term is also applied to species where this is not the case. The term 1,3-dipolar compounds is used for those in which a significant canonical resonance form can be represented by a separation of charge over three atoms (in connection with 1,3-dipolar cycloadditions).
Organic acids and derivatives	CHEMONTID:0000264	Compounds an organic acid or a derivative thereof.
Organic alkali metal salts	CHEMONTID:0004099	Organic salts of an alkali metal. The alkali metal atom is usually in its ionic form.
Organic aluminates	CHEMONTID:0001839	Organic compounds containing an aluminate oxoanion, with the formula [AlO2]-.
Organic aluminium salts	CHEMONTID:0004041	Organic salt compounds containing a tin atom in its ionic form.
Organic anions	CHEMONTID:0003608	Organic compounds that have a negative electric charge.
Organic antimonates	CHEMONTID:0001740	Organic compounds containing the antimonate oxoanion, with the formula Sb(OH)6-.
Organic antimony salts	CHEMONTID:0004078	Organic salts of antimony. They usually contain antimony in its ionic form.
Organic arsenates	CHEMONTID:0001806	Organic compounds containing the arsenate oxoanion, with the formula AsO43-.
Organic azides	CHEMONTID:0000126	Compounds bearing the group N3, viz. -N=N+=N-; usually attached to carbon, e.g. PhN3 phenyl azide or azidobenzene.
Organic beryllium salts	CHEMONTID:0004489	Organic compounds containing a beryllium ion.
Organic bromate salts	CHEMONTID:0004458	Organic salts of bromate. They contain bromate in its ionic form or conjugated to a metal atom.
Organic bromates	CHEMONTID:0001259	Organic compounds containing the bromate oxoanion, with the formula BrO3-.
Organic bromide salts	CHEMONTID:0003930	Organic compounds containing a bromine ion.
Organic cadmium salts	CHEMONTID:0004075	Organic salts of cadmium. They usually contain cadmium in its ionic form.
Organic calcium salts	CHEMONTID:0004493	Organic salts containing a calcium ion.
Organic carbonic acids	CHEMONTID:0001521	Compounds comprising the carbonic acid functional group.
Organic carbonic acids and derivatives	CHEMONTID:0000364	Compounds comprising the organic carbonic acid or a derivative thereof.
Organic cations	CHEMONTID:0003609	Organic compounds with a positive electric charge.
Organic chlorates	CHEMONTID:0001260	Organic compounds containing the chlorate oxoanion, with the formula ClO3-.
Organic chloride salts	CHEMONTID:0003931	Organic compounds containing a chlorine ion.
Organic chlorite salts	CHEMONTID:0004462	Organic salts containing the chlorite group, in its ionic form or bound to a metal atom.
Organic chlorites	CHEMONTID:0001261	Organic compounds containing the chlorite oxoanion, with the formula ClO2-.
Organic chromates	CHEMONTID:0001278	Organic compounds containing the chromate oxoanion, with the formula [CrO4]2-.
Organic chromites	CHEMONTID:0001307	Organic compounds containing the chromate oxoanion, with the formula Cr(O2)−.
Organic chromium salts	CHEMONTID:0004369	Organic salt compounds containing a chromium atom in its ionic form.
Organic chromium trioxides	CHEMONTID:0004820	Organic compounds containing a chromium trioxide moiety.
Organic cobalt salts	CHEMONTID:0003995	Organic salt compounds containing a cobalt atom in its ionic form.
Organic compounds	CHEMONTID:0000000	Compounds that contain at least one carbon atom, excluding isocyanide/cyanide and their non-hydrocarbyl derivatives, thiophosgene, carbon diselenide, carbon monosulfide, carbon disulfide, carbon subsulfide, carbon monoxide, carbon dioxide, Carbon suboxide, and dicarbon monoxide.
Organic copper salts	CHEMONTID:0004018	Organic salt compounds containing a copper atom in its ionic form.
Organic cyanamides	CHEMONTID:0000361	Organic compounds comprising the cyanamide functional group, with the general structure R1N=C=NR2.
Organic cyanides	CHEMONTID:0004504	Organic nitrogen compounds that contain the cyano (C#N) group. The group can be present either in the anionic or covalently bond form.
Organic diazonium salts	CHEMONTID:0001668	Organic compounds comprising the diazonium functional group, with the general structure R-N=N+.
Organic dichromates	CHEMONTID:0004803	Organic compounds containing a dichromate moiety.
Organic disulfides	CHEMONTID:0002800	Organosulfur compounds with the general formula RSSR' (R,R' = alkyl, aryl).
Organic dithionites	CHEMONTID:0002081	Organic compounds containing the dithionite oxoanion, with the formula [S2O4]2−.
Organic dithiophosphoric acids and derivatives	CHEMONTID:0003385	Organic compounds that contain dithiophosphoric acid or a derivative thereof, with the general formula ROP(S)(=S)OR', (R,R'=H, or organyl group).
Organic fluorophosphonic acids and derivatives	CHEMONTID:0001247	Organic compounds containing fluorophosphonic acid or a derivative thereof.
Organic hydroperoxides	CHEMONTID:0001308	Organic compounds comprising the hydroperoxide functional group, with the general formula [O-O]2-.
Organic hydroxides	CHEMONTID:0001364	Organic compounds comprising the hydroxide functional group, with the general formula OH-.
Organic hypobromites	CHEMONTID:0001444	Organic compounds containing the hypobromite oxoanion, with the formula BrO-.
Organic hypochlorites	CHEMONTID:0001526	Organic compounds containing the hypochlorite oxoanion, with the formula ClO-.
Organic hyponitrites	CHEMONTID:0001577	Organic compounds containing the hyponitrite oxoanion, with the formula ([ON=NO]2-.
Organic hypophosphites	CHEMONTID:0001589	Organic compounds containing the hypophosphite oxoanion, with the formula PO2−.
Organic hyposulfites	CHEMONTID:0002082	Organic compounds containing the hyposulfite oxoanion, with the formula [SO2]2-.
Organic iodate salts	CHEMONTID:0004460	Organic salts containing the iodate group, in its ionic form or bound to a metal atom.
Organic iodates	CHEMONTID:0001590	Organic compounds containing the iodate oxoanion, with the formula IO3-.
Organic iodide salts	CHEMONTID:0003932	Organic compounds containing a iodine ion.
Organic isocyanides	CHEMONTID:0001306	Organic compounds containing the isomer HN+#C- of hydrocyanic acid, HC#N, or its hydrocarbyl derivatives RNC (RN+#C-).
Organic lead salts	CHEMONTID:0004051	Organic salts containing a lead ion.
Organic lithium salts	CHEMONTID:0004488	Organic compounds containing a lithium ion.
Organic metal bromide salts	CHEMONTID:0004037	Organic metal salts containing a bromine atom in its ionic form.
Organic metal halides	CHEMONTID:0004491	Organic compounds containing metals and halogens. Some are ionic while others are covalently bonded.
Organic metal salts	CHEMONTID:0004036	Organic salt compounds containing a metal atom in its ionic form.
Organic metalloid salts	CHEMONTID:0003998	Organic salt compounds containing a metalloid atom in its ionic form.
Organic metavanadates	CHEMONTID:0003294	Organic compounds containing the metavanadate oxoanion, with the formula [VO4]3-.
Organic N-nitroso compounds	CHEMONTID:0004777	Organic compounds containing a n-nitroso group -NN=O.
Organic nitrates	CHEMONTID:0000395	Organic compounds containing the nitrate oxoanion, with the formula NO3-.
Organic nitrenes	CHEMONTID:0003973	Compounds containing a bond between a carbon and a nitrogen atom with only 2 pairs of unshared electrons.
Organic nitric acids	CHEMONTID:0002487	Compounds containing an organonitric acid group.
Organic nitric acids and derivatives	CHEMONTID:0000488	Compounds containing an organonitric acid group or a derivative thereof.
Organic nitrites	CHEMONTID:0000396	Organic compounds containing the nitrite oxoanion, with the formula NO2-.
Organic nitro compounds	CHEMONTID:0001152	Compounds having the nitro group, -NO2 (free valence on nitrogen), which may be attached to carbon, nitrogen (as in nitramines), or oxygen (as in nitrates), among other elements (in the absence of specification, C-nitro compounds are usually implied).
Organic nitrogen compounds	CHEMONTID:0004707	Organic compounds containing a nitrogen atom.
Organic nitrosamines	CHEMONTID:0001400	Organic compounds containing the nitrosamine functional group, with the structure R2NN=O.
Organic nitroso compounds	CHEMONTID:0004776	Organic compounds having the nitroso group, -NO, attached to carbon, or to another element, most commonly nitrogen or oxygen.
Organic nitrosonium compounds	CHEMONTID:0001520	Organic compounds containing the nitrosonium cation, with the general formula NO+.
Organic O-nitroso compounds	CHEMONTID:0004778	Organic compounds containing a n-nitroso group -ON=O.
Organic orthonitrates	CHEMONTID:0002065	Organic compounds containing the orhthonitrate oxoanion, with the formula [NO4]3−.
Organic orthovanadates	CHEMONTID:0001841	Organic compounds containing the orthovanadate oxoanion, with the formula [VO4]3-.
Organic oxides	CHEMONTID:0003940	Organic compounds containing an oxide group.
Organic oxoanionic compounds	CHEMONTID:0000463	Organic compounds containing an oxoanion.
Organic oxoazanium compounds	CHEMONTID:0001508	Organic compounds comprising the oxoazanium cation, with the formula N+=O.
Organic oxygen compounds	CHEMONTID:0004603	Organic compounds that contain one or more oxygen atoms.
Organic perbromates	CHEMONTID:0002066	Organic compounds containing the perbromate oxoanion, with the formula [BrO4]-.
Organic perchlorate salts	CHEMONTID:0003933	Organic compounds containing a perchlorate ion.
Organic perchlorates	CHEMONTID:0002067	Organic compounds containing the perchlorate oxoanion, with the formula [ClO4]-.
Organic periodates	CHEMONTID:0002068	Organic compounds containing the periodate oxoanion, with the formula [IO4]-.
Organic permanganates	CHEMONTID:0002069	Organic compounds containing the permanganate oxoanion, with the formula [MnO4]-.
Organic peroxides	CHEMONTID:0000414	Organic compounds containing the peroxide group, with the formula R1OOR2 (R1,R2=H, alkyl, aryl).
Organic peroxodisulfates	CHEMONTID:0002077	Organic compounds containing the peroxodisulfate oxoanion, with the formula [S2O8]2−.
Organic peroxomonosulfates	CHEMONTID:0002076	Organic compounds containing the peroxomonosulfate oxoanion, with the formula [SO5]2-.
Organic peroxynitrates	CHEMONTID:0001837	Organic compounds containing the peroxynitrate oxoanion, with the formula [NO4]−.
Organic peroxynitrites	CHEMONTID:0001838	Organic compounds containing the peroxonitrite oxoanion, with the formula ONOO-.
Organic perrhenates	CHEMONTID:0001222	Organic compounds containing the perrhenate oxoanion, with the formula [ReO4]-.
Organic pertechnetates	CHEMONTID:0002070	Organic compounds containing the pertechnetate oxoanion, with the formula [TcO4]-.
Organic phosphines and derivatives	CHEMONTID:0000401	Organic compounds containing a phosphine derivative, with the general formula B1P(R2)R3 (R1-R3=alkyl, aryl).
Organic phosphite salts	CHEMONTID:0004463	Organic salts containing a phosphite group, in its ionic form or bound to a metal atom.
Organic phosphites	CHEMONTID:0002071	Organic compounds containing the phosphite oxoanion, with the formula [PO3]3-.
Organic phosphonic acid diamides	CHEMONTID:0003892	Organophosphorus compounds containing a diamide derivative of phosphonic acid, with the general structure R1P(=O)(N(R2)R3)N(R4)R5, where R = organyl and R2-R5 = H or organyl group.
Organic phosphonic acids	CHEMONTID:0001302	Organic compounds containing phosphonic acid.
Organic phosphonic acids and derivatives	CHEMONTID:0000419	Organic compounds containing phosphonic acid or a derivative thereof.
Organic phosphoramides	CHEMONTID:0001204	Organic compounds containing the phosphoric acid amide functional group.
Organic phosphoric acid diamides	CHEMONTID:0003662	Organophosphorus compounds with the general formula RNP(R2)(O)=O (R=alkyl, aryl; R2 = amine group).
Organic phosphoric acid halides	CHEMONTID:0001206	Organic compounds containing the phosphoric acid halide functional group with the general structure OP(O)(=O)OX (X = halogen atom).
Organic phosphoric acid monoamides	CHEMONTID:0002857	Organophosphorus compounds with the general formula RNP(O)(O)=O (R=alkyl, aryl).
Organic phosphoric acid triamides	CHEMONTID:0003871	Organophosphorus compounds with the general formula RNP(R2)(R3)=O (R=alkyl, aryl; R2-R3 = amine groups).
Organic phosphoric acids	CHEMONTID:0001574	Organic compounds containing phosphoric acid, with the general structure OP(O)(=O)O.
Organic phosphoric acids and derivatives	CHEMONTID:0000402	Organic compounds containing phosphoric acid or a derivative thereof.
Organic plumbates	CHEMONTID:0001153	Organic compounds containing a plumbate oxoanion, with the formula [PbO3]2-.
Organic Polymers	CHEMONTID:0003297	Organic compounds, generally large molecules or macromolecules, which are composed of many repeating units.
Organic post-transition metal salts	CHEMONTID:0004040	Organic salt compounds containing a post-transition metal atom in its ionic form.
Organic potassium salts	CHEMONTID:0003927	Organic compounds containing a potassium ion.
Organic pyrophosphates	CHEMONTID:0001804	Organic compounds containing the pyrophosphate oxoanion, with the structure OP([O-])(=O)OP(O)([O-])=O.
Organic pyrosulfates	CHEMONTID:0002078	Organic compounds containing the pyrosulfate oxoanion, with the structure OS([O-])(=O)OS(O)([O-])=O.
Organic S-nitroso compounds	CHEMONTID:0004779	Organic compounds containing a n-nitroso group -SN=O.
Organic salts	CHEMONTID:0003865	Organic compounds consisting of an assembly of cations and anions.
Organic selenates	CHEMONTID:0002072	Organic compounds containing the selenate oxoanion, with the formula [SeO4]2-.
Organic selenite salts	CHEMONTID:0004459	Organic salts containing a selenite group, in its ionic form or bound to a metal atom.
Organic selenites	CHEMONTID:0002073	Organic compounds containing the selenite oxoanion, with the formula [SeO3]2-.
Organic silver salts	CHEMONTID:0004063	Organic salt compounds containing a copper atom either in its ionic form or bonded to another atom.
Organic sodium salts	CHEMONTID:0003928	Organic compounds containing a sodium ion.
Organic stannates	CHEMONTID:0001840	Organic compounds containing a stannate oxoanion, with the formula [SnO3]2-.
Organic sulfate salts	CHEMONTID:0003929	Organic compounds containing a sulfate ion.
Organic sulfite salts	CHEMONTID:0004455	Organic salts of the sulfite ion.
Organic sulfites	CHEMONTID:0004456	Organic compounds containing the selenite oxoanion, with the formula [SO3]2-, or its conjugated base.
Organic sulfonamides	CHEMONTID:0004439	Organic compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=H or organyl; R2,R3=H, alkyl, aryl).
Organic sulfonic acids	CHEMONTID:0004438	Organic compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2OH (R= H or organyl group).
Organic sulfonic acids and derivatives	CHEMONTID:0004434	Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R= H or organyl group, X=any heteroatom).
Organic sulfonic anhydrides	CHEMONTID:0004437	Organic compounds having the structure RS(=O)2OS(=O)2R', where R , R' = H or organyl group.
Organic sulfonium compounds	CHEMONTID:0000508	Organic compounds containing the sulfonium cation, with the general formula [SR3]+ (R=any atom).
Organic sulfuric acids	CHEMONTID:0001180	Organic compounds containing the sulfuric acid functional group, with the generic structure HOS(=O)(=O)OH.
Organic sulfuric acids and derivatives	CHEMONTID:0000403	Organic compounds containing the sulfuric acid or a derivative thereof.
Organic sulfuryl bromides	CHEMONTID:0001037	Organic compounds containing the sulfuryl bromide functional group.
Organic sulfuryl chlorides	CHEMONTID:0001038	Organic compounds containing the sulfuryl chloride functional group.
Organic sulfuryl fluorides	CHEMONTID:0001039	Organic compounds containing the sulfuryl fluoride functional group.
Organic sulfuryl halides	CHEMONTID:0002869	Organic compounds containing the sulfuryl halide group.
Organic sulfuryl iodides	CHEMONTID:0001040	Organic compounds containing the sulfuryl iodide functional group.
Organic superoxides	CHEMONTID:0000230	Organic compounds containing a superoxide oxyanion.
Organic tetrathionates	CHEMONTID:0002079	Organic compounds containing the tetrathionate oxoanion, with the formula [S4O6]2−.
Organic thiocarbonic acid derivatives	CHEMONTID:0001672	Organic compounds containing the thiocarbonic acid structure or a derivative thereof.
Organic thiocarbonic acids	CHEMONTID:0001193	Organic compounds comprising the thiocarbonic acid group, with the general structure HOC(=S)OH.
Organic thionitrous acids	CHEMONTID:0004780	Organic compounds containing a thionitrous acid, -HSN=O.
Organic thionylimides	CHEMONTID:0003699	Organic compounds that contain the thionylimide group (N=S=O).
Organic thioperoxides	CHEMONTID:0003135	Organosulfur compounds with the general formula RSOR' (R,R' = organyl).
Organic thiophosphonic acid derivatives	CHEMONTID:0001163	Organic compounds containing thiophosphonic acid functional group. Thiophosphonic acid is a phosphorus compound with the formula OP(O)(=S).
Organic thiophosphoric acid amides	CHEMONTID:0001571	Organic compounds containing the thiophosphoric acid amide functional group RN(R')OP(O)(O)=S, R,R'=H, alkyl, or aryl group.
Organic thiophosphoric acid halides	CHEMONTID:0001573	Organic compounds containing the thiophosphoric acid halide functional group, with the general structure RP(R')(X)=S, where R,R',R'' = O,N and X = halogen group.
Organic thiophosphoric acids	CHEMONTID:0001219	Organic compounds containing the thiophosphoric acid group ([H]OP(=S)(O[H])O[H]).
Organic thiophosphoric acids and derivatives	CHEMONTID:0001303	Organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure RP(R')(R'')=S, where R,R',R'' = O,N, halogen residue.
Organic thiosulfate salts	CHEMONTID:0004457	Organic salts of the thiosulfate ion.
Organic thiosulfates	CHEMONTID:0002080	Organic compounds containing the thiosulfate oxoanion, with the formula [S2O3]2-, or its conjugate base.
Organic thiosulfinic acids	CHEMONTID:0004703	Organic compounds containing a thiosulfinyl group (HS(S)OH). They have the general structure RS(=S)OH, where R = H or organyl.
Organic thiosulfuric acids and derivatives	CHEMONTID:0002035	Organic compounds containing the thiosulfuric acid functional group or a derivative thereof.
Organic tin salts	CHEMONTID:0004038	Organic salt compounds containing a tin atom in its ionic form.
Organic transition metal salts	CHEMONTID:0003997	Organic salt compounds containing a transition metal atom in its ionic form.
Organic triazanes	CHEMONTID:0003992	Organic compounds containing the triazane group (NH2NHNH2) or a hydrocarbyl derivative thereof.
Organic triazenes	CHEMONTID:0001898	Organic compounds containing the triazene group (-N-N=N), which consists of an amine directly bonding to an azo group.
Organic trisulfides	CHEMONTID:0002799	Organosulfur compounds with the general formula RSSSR' (R,R'=alkyl, aryl).
Organic zwitterions	CHEMONTID:0003610	Organic neutral compounds having formal unit electrical charges of opposite sign.
Organo-alkali-metal compounds	CHEMONTID:0001372	Organic compounds containing an alkali metal atom.
Organo-post-transition metal compounds	CHEMONTID:0001523	Organic compounds containing a post-transition metal atom.
Organoalkaline-earth metal compounds	CHEMONTID:0000277	Organic compounds containing an alkaline earth metal atom.
Organoaluminium compounds	CHEMONTID:0001529	Compounds containing bond between a carbon atom and an aluminum atom.
Organoantimony compounds	CHEMONTID:0000349	Compounds containing a bond between a carbon atom and an antimony atom.
Organoarsenic compounds	CHEMONTID:0000405	Compounds containing bond between a carbon atom and an arsenic atom.
Organoarsenic sulfides	CHEMONTID:0004241	Organoarsenic compounds with the general formula R[As]S, where R = organyl group.
Organoarsinous acid esters	CHEMONTID:0004247	Organoarsonous acid derivatives, where the hydrogen atom of the hydroxyl group is replaced by an organyl group.
Organoarsinous acids	CHEMONTID:0004248	As-hydrocarbyl compounds with the general formula R2As(OH), where R is an organic group.
Organoarsonous acids	CHEMONTID:0003337	As-hydrocarbyl compounds with the general formula RAs(OH)2, where R is an organic group.
Organoastatides	CHEMONTID:0001514	Compounds containing a chemical bond between a carbon atom and an astatin atom.
Organoazides	CHEMONTID:0004467	Compounds bearing the group N3, viz. -N=N+=N- attached to an organic group.
Organoboron compounds	CHEMONTID:0002795	Organic compounds containing a carbon-boron bond.
Organoboroxines	CHEMONTID:0003222	Organic compounds containing a boroxine ring B-substituted with an organyl group.
Organobromides	CHEMONTID:0001515	Compounds containing a chemical bond between a carbon atom and a bromine atom.
Organochlorides	CHEMONTID:0001516	Compounds containing a chemical bond between a carbon atom and a chlorine atom.
Organochlorosilanes	CHEMONTID:0004444	Organosilicon compounds where the tetravalent silicon atom is linked to one or more chlorine atoms.
Organochromium compounds	CHEMONTID:0004073	Compounds containing a bond between a carbon atom and a chromium atom.
Organocopper compounds	CHEMONTID:0004017	Compounds containing a bond between a carbon atom and a copper atom.
Organofluorides	CHEMONTID:0001517	Compounds containing a chemical bond between a carbon atom and a fluorine atom.
Organogold compounds	CHEMONTID:0000473	Organic compounds containing a bond between a carbon atom and a gold atom.
Organohalogen compounds	CHEMONTID:0000267	Organic compounds containing a bond between a carbon atom and a halogen atom (At, F, Cl, Br, I).
Organoheterocyclic compounds	CHEMONTID:0000002	Compounds containing a ring with least one carbon atom and one non-carbon atom.
Organoheterosilanes	CHEMONTID:0004445	Organosilicon compounds where the tetravalent silicon atom is linked to one or more heteroatoms.
Organoiodides	CHEMONTID:0001518	Compounds containing a chemical bond between a carbon atom and an iodine atom.
Organolead compounds	CHEMONTID:0004024	Compounds containing bond between a carbon atom and a lead atom.
Organolead sulfides	CHEMONTID:0004288	Organolead compounds containing a divalent selenium atom linked to two lead atoms, each linked to at least one organyl group.
Organolithium compounds	CHEMONTID:0000406	Organic compounds containing a bond between a carbon atom and lithium atom.
Organomagnesium compounds	CHEMONTID:0000287	Organic compounds containing a bond between a carbon atom and magnesium atom.
Organomagnesium halides	CHEMONTID:0004594	Organomagnesium compounds with the formula RMgX, where R=organyl group, and X = halogen atom.
Organomercurial compounds	CHEMONTID:0000407	Organic compounds containing a bond between a carbon atom and mercury atom.
Organometallic compounds	CHEMONTID:0000462	Organic compounds containing a bond between a carbon atom and metal atom.
Organometallic peroxides	CHEMONTID:0004614	Organic compounds that contain a peroxide group substituted with a an organometallic group.
Organometalloid compounds	CHEMONTID:0001370	Organic compounds containing a metalloid atom.
Organonickel compounds	CHEMONTID:0004492	Organic compounds containing a bond between a carbon atom and a nickel atom.
Organonitrogen compounds	CHEMONTID:0000278	Organic compounds containing a nitrogen atom.
Organooxygen compounds	CHEMONTID:0000323	Organic compounds containing a bond between a carbon atom and an oxygen atom.
Organophosphine oxides	CHEMONTID:0001309	Organic compounds containing the phosphine oxide group, with the general formula R3P=O or R3P+O-.
Organophosphinic acids and derivatives	CHEMONTID:0003014	P-hydrocarbyl derivatives of phosphinic acid.
Organophosphorotrithioic acids and derivatives	CHEMONTID:0001570	Organic compounds containing the organophosphorotrithioic acid structure or a derivative thereof. They have the general structure ROP(=S)(SR')SR\", where R-R\"= any atom.
Organophosphorus compounds	CHEMONTID:0000400	Organic compounds containing the phosphorus atom.
Organopnictogen compounds	CHEMONTID:0004557	Compounds containing a bond between carbon a pnictogen atom. Pnictogens are p-block element atoms that are in the group 15 of the periodic table.
Organoselenium compounds	CHEMONTID:0002468	Organic compounds containing a carbon-selenium bond.
Organosilicon compounds	CHEMONTID:0003194	Organic compounds containing a C[Si] bond.
Organosilver compounds	CHEMONTID:0004025	Organic compounds containing a bond between a carbon atom and a silver atom.
Organosulfenic acid amides	CHEMONTID:0001172	Compounds derived from a sulfenic acid, RSOH (R= organyl, not H), by replacement of -OH by -NR2.
Organosulfenic acid halides	CHEMONTID:0001174	Compounds derived from a sulfenic acid, RSOH (R = organyl, not H), where the hydroxyl group is replace by a halogen atom.
Organosulfenic acids	CHEMONTID:0001235	Compounds containing a sulfenic acid functional group, with the general structure RSOH (R not H).
Organosulfenic acids and derivatives	CHEMONTID:0000268	Compounds derived from sulfenic acid, with the general formula R1SR2 ( R1= organyl, R2=any heteroatom).
Organosulfonamides	CHEMONTID:0001585	Compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=alkyl, aryl; R2,R3=H, alkyl, aryl).
Organosulfonic acid esters	CHEMONTID:0001178	Esters of sulfonic acid, which have the general structure RS(=O)2OR' (R,R' = organyl, not H).
Organosulfonic acids	CHEMONTID:0001179	Compounds containing the sulfonic acid group, which has the general structure RS(=O)2OH (R is not a hydrogen atom).
Organosulfonic acids and derivatives	CHEMONTID:0000270	Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R=alkyl, aryl; X=any heteroatom).
Organosulfonic anhydrides	CHEMONTID:0003990	Organic compounds having the structure RS(=O)2OS(=O)2R', where R = organyl group and R' = H or organyl group.
Organosulfur compounds	CHEMONTID:0000004	Organic compounds containing a carbon-sulfur bond.
Organotellurium compounds	CHEMONTID:0002469	Compounds containing bond between a carbon atom and a tellurium atom.
Organotetrahaloarsoranes	CHEMONTID:0004243	Organoarsenic compounds, having a pentavalent arsenic atom linked to four halogen atoms and a organic group.
Organothalium compounds	CHEMONTID:0004539	Compounds containing a bond between a carbon atom and a thalium atom.
Organothiophosphorus compounds	CHEMONTID:0001438	Organic derivatives of thiophosphonic acid, thiophosphoric acid, dithiophosphoric acid, or phosphorotrithioic acid, or derivatives thereof. Thiophosphonic acid, dithiophosphoric acid, thiophosphoric acid, and phosphorotrithioic acid are thiophosphorus compounds with the formula OP(O)(=S), OP(S)(=S)O, OP(O)(=S)O, and OP(=S)(S)S, respectively.
Organotin compounds	CHEMONTID:0001524	Compounds containing bond between a carbon atom and a tin atom.
Organotin selenides	CHEMONTID:0004285	Organotin compounds containing a divalent selenium atom linked to two tin atoms, each linked to at least one organyl group.
Organotin sulfides	CHEMONTID:0004286	Organotin compounds containing a divalent sulfur atom linked to two tin atoms, each linked to at least one organyl group.
Organotin tellurides	CHEMONTID:0004287	Organotin compounds containing a divalent tellurium atom linked to two tin atoms, each linked to at least one organyl group.
Organotransition metal compounds	CHEMONTID:0001371	Organic compounds containing a transition metal atom.
Organozinc compounds	CHEMONTID:0004592	Organometallic compounds that contain a chemical bond between a carbon atom and a zinc atom.
Ormosia-type alkaloids	CHEMONTID:0002825	Aloperine alkaloids with a structure based on the ormosanine skeleton.
Ortho acids	CHEMONTID:0002928	Ortho acid derivatives of carboxylic acids, with the general formula RC(OH)3.
Ortho amides	CHEMONTID:0002927	Hypothetical Compounds having the general structure RC(NH2)3, and N-substituted derivatives thereof.
Ortho cresols	CHEMONTID:0001274	Organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively.
Ortho dioxins	CHEMONTID:0001385	Compounds containing a dioxin ring, in which the two oxygen atoms are at positions 1 and 2 respectively.
Ortho esters	CHEMONTID:0002926	Compounds having the general structure RC(OR')3 ( R' not H), or the structure C(OR')4 ( R' not H).
Ortho thiazepines	CHEMONTID:0001353	Compounds containing a thiazepine ring, in which the sulfur and nitrogen atoms are at positions 1 and 2 respectively.
Orthocarboxylic acid derivatives	CHEMONTID:0001236	Organic compounds containing the orhtocarboxylic acid functional group, with the RC(X)(X)X (R=H, alkyl, aryl; X=OH, alkoxy, aryloxy, substituted amino, etc.).
OS-thioperoxols	CHEMONTID:0003157	Thioperoxols with the general formula R-OSH (R = organyl group).
Other glycerolipids	CHEMONTID:0001512	Glycerolipids that do not belong to either the class Alk(en)yl Diacylglycerols, Diacylglycerols, Glycosylglycerols, Monoacylglycerols, Other Glycerolipids or Triacylglycerols.
Other glycerophosphoinositol phosphates	CHEMONTID:0001718	Glycerophosphoinositol phosphates not belonging to Lysophosphatidylinositol Phosphates, or the Phosphatidylinositol Phosphates.
Other hydroperoxyeicosapolyenoic acids	CHEMONTID:0001525	Hydroperoxyeicosapolyenoic acids which do not belong to the hydroperoxyeicosapentaenoic acids, the hydroperoxyeicosatetraenoic acids, or the hydroperoxyeicosatrienoic acids.
Other hydroxyeicosapolyenoic acids	CHEMONTID:0001422	Hydroxyeicosapolyenoic acids which do not belong to the Hydroxyeicosapentaenoic acids, the Hydroxyeicosatetraenoic acids, or the Hydroxyeicosatrienoic acids.
Other mixed metal/non-metal oxoanionic compounds	CHEMONTID:0001442	Inorganic compounds containing a non-metal atom linked to a metallic oxoanionic moiety.
Other non-metal halides	CHEMONTID:0000437	Inorganic compounds containing 'other non-metals' and halogen.
Other non-metal hydrides	CHEMONTID:0000552	Inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'.
Other non-metal nitrides	CHEMONTID:0000553	Inorganic compounds of nitrogen where nitrogen has a formal oxidation state of −3, and the heaviest atom bonded to it belongs to the class of 'other non-metals'.
Other non-metal organides	CHEMONTID:0000453	Inorganic compounds belonging to either of the other non-metal Hydrides, other non-metal nitrides, other non-metal oxides, or the other non-metal sulfides.
Other non-metal oxides	CHEMONTID:0000554	Inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of 'other non-metals'.
Other non-metal sulfides	CHEMONTID:0000555	Inorganic compounds containing a sulfur atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of other non-metals.
Oxaborine derivatives	CHEMONTID:0001717	Compounds containing a six-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms.
Oxaborole derivatives	CHEMONTID:0002227	Compounds containing a five-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms.
Oxacephems	CHEMONTID:0000171	Organic compounds containing the oxacepehem skeleton, which is similar to a cephem, but with oxygen substituted for the sulfur.
Oxacyclic compounds	CHEMONTID:0004140	Organic compounds containing an heterocycle with at least one oxygen atom linked to a ring carbon.
Oxadiazines	CHEMONTID:0004736	Heterocyclic compounds containing an oxadiazine ring, which is an unsaturated six-membered heterocycle that consists of one oxygen 2 nitrogen, and 3 carbon atoms.
Oxadiazoles	CHEMONTID:0001822	Organic compounds containing an oxadiazole ring, which is a five-member aromatic heterocycle with two nitrogen atoms, an oxygen atom, and a carbon atom.
Oxadiazolidines	CHEMONTID:0001933	Organic compounds containing an oxadiazole ring, which is a five-member saturated aliphatic heterocycle with two nitrogen atoms, an oxygen atom, and two carbon atoms.
Oxaergolines	CHEMONTID:0002681	Alkaloids with a structure based on the oxaergoline skeleton, an analog of ergoline obtained by substituted one of the pyridine C atom by an oxygen atom.
Oxamorphinans	CHEMONTID:0001785	Polycyclic compounds with a four-ring skeleton with three condensed six-member rings forming a partially hydrogenated naphthopyran moiety, one of which is aromatic while the two others are alicyclic.
Oxanes	CHEMONTID:0002012	Compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms.
Oxaphospholanes	CHEMONTID:0000782	Compounds containing an oxaphospholane moiety, which consists of a saturated aliphatic five-member ring with two oxygen atoms, a phosphorus atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxaphosphane, and 1,3-oxaphospholane.
Oxasteroids and derivatives	CHEMONTID:0002382	Steroid derivatives where a carbon atom of the steroid is replaced by an oxygen atom.
Oxathianes	CHEMONTID:0001889	Compounds containing an oxathiane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiane, 1,3-oxathiane,and 1,4-oxathiane.
Oxathiaphospholanes	CHEMONTID:0002649	Heterocyclic compounds containing an oxathiophospholane ring, which is a saturated, five-membered ring with one oxygen atom, one sulfur atom, one phosphorus atom and two carbon atoms.
Oxathiazolidines	CHEMONTID:0002578	Heterocyclic compounds containing an oxathiazolidine, a saturated five-membered ring having two carbon atoms, one oxygen atom, one nitrogen atom, and one sulfur atom.
Oxathietanes	CHEMONTID:0001886	Compounds containing an oxathietane moiety, which consists of a saturated aliphatic four-member ring with one oxygen atom, a sulfur atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxathietane, and 1,3-oxathietane.
Oxathiins	CHEMONTID:0002058	Compounds containing an oxathiin moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiin, 1,3-oxathiin,and 1,4-oxathiin.
Oxathiolanes	CHEMONTID:0000106	Compounds containing an oxathiolane moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, a sulfur atom, and three carbon atoms. Isomers of oxaphospholane include meta-oxathiolane, and ortho-oxathiolane.
Oxathioles	CHEMONTID:0002261	Organic heterocyclic compounds containing a saturated five-membered ring with three carbon atoms, one oxygen atom, one sulfur atom, and one double bond.
Oxatriazoles	CHEMONTID:0001931	Compounds containing an oxatriazole moiety, which consists of an unsaturated aliphatic five-member ring with one oxygen atom, three nitrogen, one carbon atom, and two double bonds. Isomers of oxatriazole include 1,2,3,4-oxatriazole, and 1,2,3,5-oxatriazole.
Oxatriazolidines	CHEMONTID:0001932	Organic compounds containing an oxatriazolidine ring, which is a five-member saturated aliphatic heterocycle with three nitrogen atoms, an oxygen atom, and a carbon atom.
Oxazaphosphinanes	CHEMONTID:0002466	Organic heterocyclic compounds containing an oxazaphosphinane ring, which consists of three carbon atoms, one nitrogen atom, and one phosphorus atom.
Oxazepines	CHEMONTID:0000066	Compounds containing an oxazepine moiety, which consists of an unsaturated aliphatic seven-member ring with one oxygen atom, a nitrogen atom, and five carbon atoms. Isomers of oxazepine include 1,2-oxazepine, 1,3-oxazepine,and 1,4-oxazepine.
Oxazinanes	CHEMONTID:0000107	Compounds containing an oxazinane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxazinane, 1,3-oxazinane, and 1,4-oxazinane.
Oxazines	CHEMONTID:0000082	Compounds containing an oxazine moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, four carbon atoms, and two double bonds. Isomers of oxaphospholane include 1,2-oxazine, 1,3-oxazine, and 1,4-oxazine.
Oxaziridines	CHEMONTID:0003092	Organic heterocyclic compounds containing oxaziridine, a three-membered ring containing an oxygen atom, a carbon atom, and a nitrogen atom.
Oxazoles	CHEMONTID:0000083	Compounds containing an oxazole ring, which is a five-membered aromatic heterocycle with one oxygen, one nitrogen, and three carbon atoms. Isomers include 1,2-oxazole and 1,3-oxazole.
Oxazolidinediones	CHEMONTID:0000197	Compounds containing an oxazolidine ring which bears two ketones.
Oxazolidines	CHEMONTID:0000108	Compounds containing an oxazolidine moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, one nitrogen, three carbon atoms, and two double bonds.
Oxazolidinones	CHEMONTID:0000196	Compounds containing an oxazolidinone moiety, which is an oxazolidine bearing a ketone group.
Oxazolines	CHEMONTID:0000084	Organic compounds containing 1,3-oxazoline, a five-membered ring with a nitrogen and an oxygen atoms at the 1- and 3-position, respectively. Additionally, it contains two double bonds.
Oxazolopyrazines	CHEMONTID:0002197	Polycyclic compounds containing an oxazole ring fused to a pyrazine ring.
Oxazolopyridines	CHEMONTID:0002118	Polycyclic compounds containing an oxazole ring fused to a pyridine ring.
Oxepanes	CHEMONTID:0001729	Compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms.
Oxetane amino acids and derivatives	CHEMONTID:0001695	Sugar amino acids containing an oxetane ring between the carboxy- and the amino terminals of the amino acid chain.
Oxetanes	CHEMONTID:0000070	Compounds containing an oxetane ring, which is a four-member saturated aliphatic ring with an oxygen, and three carbon atoms.
Oxetenes	CHEMONTID:0000073	Compounds containing an oxetene ring, which is a four-member unsaturated aliphatic ring with an oxygen, three carbon atoms, and one CC double bond.
Oxime carbamates	CHEMONTID:0004752	Oxime ether derivatives with the general formula CC(R)=NOC(=O)N(R')R\", where R-R\" = H or organyl.
Oxime esters	CHEMONTID:0003879	Organic compounds containing an ester derivative of the oxime functional group.
Oxime ethers	CHEMONTID:0001010	Compounds containing the oxime ether functional group, with the general structure R1(R2)C=NOR3 ( R3 not H).
Oxime organothiophosphates	CHEMONTID:0004765	Organic compounds containing an oxime group, which is O-substituted with a thiophosphoric acid ester.
Oximes	CHEMONTID:0000411	Compounds containing the oxime functional group, with the general structure R1(R2)C=NOH.
Oxirane carboxylic acids	CHEMONTID:0002409	Compounds containing an oxirane ring bearing a carboxylic acid group.
Oxirane carboxylic acids and derivatives	CHEMONTID:0001864	Compounds containing an oxirane ring bearing a carboxylic acid group (or a derivative thereof).
Oxirenes	CHEMONTID:0004170	Organic compounds containing oxirene, an unsaturated three-membered ring with two carbon atoms and one oxygen atom.
Oxocins	CHEMONTID:0001796	Compounds containing an oxocin ring, which is a eight-member unsaturated aromatic ring containing one oxygen atom and seven carbon atoms.
Oxoeicosapolyenoic acids	CHEMONTID:0000393	Eicosapolyenoic acids (C20 fatty acid with more than one C=C double bonds on the chain).
Oxoisoaporphines	CHEMONTID:0004118	Alkaloids with a structure that contains the isoaporphine skeleton with an oxo group at the 7-position.
Oxolanes	CHEMONTID:0001967	Organic compounds containing an oxolane (tetrahydrofuran) ring, which is a saturated aliphatic five-member ring containing one oxygen and five carbon atoms.
Oxonium ylides	CHEMONTID:0003701	Compounds having the general structure R2[O+]-C-R2. Oxonium ylides also constituted a class of 1,3-dipolar compounds of general structure R2C=[O+]-Y- , comprising carbonyl imides, carbonyl oxides and carbonyl ylides.
Oxoprolines	CHEMONTID:0002089	Compounds containing an oxoproline moiety, which consists of a pyrrolidine ring bearing a carboxylic acid group at the ring position 2, and a ketone group.
Oxosteroids	CHEMONTID:0001194	Steroid derivatives carrying a C=O group attached to steroid skeleton.
Oxygen-containing organoarsenic compounds	CHEMONTID:0004280	Organoarsenic compounds that containing an oxygen atom.